C24H27FN4OS — CID 112784561
N-(2-butan-2-ylphenyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 112784561) has the molecular formula C24H27FN4OS and a molecular weight of 438.57 g/mol. Its IUPAC name is N-(2-butan-2-ylphenyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(2-butan-2-ylphenyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 112784561 |
| Molecular Formula | C24H27FN4OS |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-(2-butan-2-ylphenyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccccc2C(C)CC)nnc1-c1ccccc1F |
| InChI | InChI=1S/C24H27FN4OS/c1-5-15-29-22(19-12-7-9-13-20(19)25)27-28-24(29)31-17(4)23(30)26-21-14-10-8-11-18(21)16(3)6-2/h5,7-14,16-17H,1,6,15H2,2-4H3,(H,26,30) |
| InChIKey | SNZGTMHRYZHRMX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|