C13H16N4O3S2 — CID 7785141
4-[3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)phenyl]sulfonylmorpholine (PubChem CID 7785141) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-[3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 7785141 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 4-[3-(1H-1,2,4-triazol-5-ylsulfanylmethyl)phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1cccc(CSc2ncn[nH]2)c1)N1CCOCC1 |
| InChI | InChI=1S/C13H16N4O3S2/c18-22(19,17-4-6-20-7-5-17)12-3-1-2-11(8-12)9-21-13-14-10-15-16-13/h1-3,8,10H,4-7,9H2,(H,14,15,16) |
| InChIKey | BVGWKBRJDNCMMR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |