C21H29NO3S2 — CID 8513394
4-[3-(1-adamantylsulfanylmethyl)phenyl]sulfonylmorpholine (PubChem CID 8513394) has the molecular formula C21H29NO3S2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-[3-(1-adamantylsulfanylmethyl)phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-(1-adamantylsulfanylmethyl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 8513394 |
| Molecular Formula | C21H29NO3S2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-[3-(1-adamantylsulfanylmethyl)phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1cccc(CSC23CC4CC(CC(C4)C2)C3)c1)N1CCOCC1 |
| InChI | InChI=1S/C21H29NO3S2/c23-27(24,22-4-6-25-7-5-22)20-3-1-2-16(11-20)15-26-21-12-17-8-18(13-21)10-19(9-17)14-21/h1-3,11,17-19H,4-10,12-15H2 |
| InChIKey | JQMPRFJVTZHYCZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |