C18H25N3O3S2 — CID 26010372
4-[3-[[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]phenyl]sulfonylmorpholine (PubChem CID 26010372) has the molecular formula C18H25N3O3S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-[3-[[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-[[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 26010372 |
| Molecular Formula | C18H25N3O3S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-[3-[[(3aR,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanylmethyl]phenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1cccc(CSC2=N[C@@H]3CCCC[C@@H]3N2)c1)N1CCOCC1 |
| InChI | InChI=1S/C18H25N3O3S2/c22-26(23,21-8-10-24-11-9-21)15-5-3-4-14(12-15)13-25-18-19-16-6-1-2-7-17(16)20-18/h3-5,12,16-17H,1-2,6-11,13H2,(H,19,20)/t16-,17+ |
| InChIKey | MGAZFWWJLPSSPI-CALCHBBNSA-N |
| XLogP | 2.21 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |