C22H23N3O4S — CID 10550306
N-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-hydroxyphenyl]-2-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 10550306) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-hydroxyphenyl]-2-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | N-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-hydroxyphenyl]-2-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 10550306 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-hydroxyphenyl]-2-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(N2CCCC2)cc1)Nc1cc(CC2SC(=O)NC2=O)ccc1O |
| InChI | InChI=1S/C22H23N3O4S/c26-18-8-5-15(12-19-21(28)24-22(29)30-19)11-17(18)23-20(27)13-14-3-6-16(7-4-14)25-9-1-2-10-25/h3-8,11,19,26H,1-2,9-10,12-13H2,(H,23,27)(H,24,28,29) |
| InChIKey | MMIZVUQMNSKVNQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|