C15H25N3O3 — CID 143283889
2-amino-3-[4-[[3-(ethylamino)-3-methoxypropyl]amino]phenyl]propanoic acid (PubChem CID 143283889) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-amino-3-[4-[[3-(ethylamino)-3-methoxypropyl]amino]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[[3-(ethylamino)-3-methoxypropyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143283889 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-amino-3-[4-[[3-(ethylamino)-3-methoxypropyl]amino]phenyl]propanoic acid |
| SMILES | CCNC(CCNc1ccc(CC(N)C(=O)O)cc1)OC |
| InChI | InChI=1S/C15H25N3O3/c1-3-17-14(21-2)8-9-18-12-6-4-11(5-7-12)10-13(16)15(19)20/h4-7,13-14,17-18H,3,8-10,16H2,1-2H3,(H,19,20) |
| InChIKey | BYXYPCSCUPBHFO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|