C15H21FN2O4 — CID 175284109
2-amino-5-[[4-(2-fluoroethylamino)phenyl]methyl]hexanedioic acid (PubChem CID 175284109) has the molecular formula C15H21FN2O4 and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-amino-5-[[4-(2-fluoroethylamino)phenyl]methyl]hexanedioic acid.
| Compound Name | 2-amino-5-[[4-(2-fluoroethylamino)phenyl]methyl]hexanedioic acid |
|---|---|
| PubChem CID | 175284109 |
| Molecular Formula | C15H21FN2O4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-amino-5-[[4-(2-fluoroethylamino)phenyl]methyl]hexanedioic acid |
| SMILES | NC(CCC(Cc1ccc(NCCF)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H21FN2O4/c16-7-8-18-12-4-1-10(2-5-12)9-11(14(19)20)3-6-13(17)15(21)22/h1-2,4-5,11,13,18H,3,6-9,17H2,(H,19,20)(H,21,22) |
| InChIKey | KZBQAFOOFQRNCL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |