C14H15FN2O4 — CID 89445670
(2S)-2-amino-5-[(4-cyano-3-(18F)fluorophenyl)methyl]hexanedioic acid (PubChem CID 89445670) has the molecular formula C14H15FN2O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2S)-2-amino-5-[(4-cyano-3-(18F)fluorophenyl)methyl]hexanedioic acid.
| Compound Name | (2S)-2-amino-5-[(4-cyano-3-(18F)fluorophenyl)methyl]hexanedioic acid |
|---|---|
| PubChem CID | 89445670 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (2S)-2-amino-5-[(4-cyano-3-(18F)fluorophenyl)methyl]hexanedioic acid |
| SMILES | N#Cc1ccc(CC(CC[C@H](N)C(=O)O)C(=O)O)cc1[18F] |
| InChI | InChI=1S/C14H15FN2O4/c15-11-6-8(1-2-10(11)7-16)5-9(13(18)19)3-4-12(17)14(20)21/h1-2,6,9,12H,3-5,17H2,(H,18,19)(H,20,21)/t9?,12-/m0/s1/i15-1 |
| InChIKey | BAKBMQXVFXGBAW-LJRNYKQSSA-N |
| XLogP | 1.13 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |