C17H16ClFN2O2 — CID 66718448
methyl 2-amino-3-[4-(4-cyano-3-fluorophenyl)phenyl]propanoate;hydrochloride (PubChem CID 66718448) has the molecular formula C17H16ClFN2O2 and a molecular weight of 334.78 g/mol. Its IUPAC name is methyl 2-amino-3-[4-(4-cyano-3-fluorophenyl)phenyl]propanoate;hydrochloride.
| Compound Name | methyl 2-amino-3-[4-(4-cyano-3-fluorophenyl)phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 66718448 |
| Molecular Formula | C17H16ClFN2O2 |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | methyl 2-amino-3-[4-(4-cyano-3-fluorophenyl)phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)C(N)Cc1ccc(-c2ccc(C#N)c(F)c2)cc1.Cl |
| InChI | InChI=1S/C17H15FN2O2.ClH/c1-22-17(21)16(20)8-11-2-4-12(5-3-11)13-6-7-14(10-19)15(18)9-13;/h2-7,9,16H,8,20H2,1H3;1H |
| InChIKey | QGCPUNGQJSRSQM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |