C15H18Cl2N2O3 — CID 174643008
methyl 2-amino-3-[4-(2-oxo-1H-pyridin-4-yl)phenyl]propanoate;dihydrochloride (PubChem CID 174643008) has the molecular formula C15H18Cl2N2O3 and a molecular weight of 345.23 g/mol. Its IUPAC name is methyl 2-amino-3-[4-(2-oxo-1H-pyridin-4-yl)phenyl]propanoate;dihydrochloride.
| Compound Name | methyl 2-amino-3-[4-(2-oxo-1H-pyridin-4-yl)phenyl]propanoate;dihydrochloride |
|---|---|
| PubChem CID | 174643008 |
| Molecular Formula | C15H18Cl2N2O3 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | methyl 2-amino-3-[4-(2-oxo-1H-pyridin-4-yl)phenyl]propanoate;dihydrochloride |
| SMILES | COC(=O)C(N)Cc1ccc(-c2cc[nH]c(=O)c2)cc1.Cl.Cl |
| InChI | InChI=1S/C15H16N2O3.2ClH/c1-20-15(19)13(16)8-10-2-4-11(5-3-10)12-6-7-17-14(18)9-12;;/h2-7,9,13H,8,16H2,1H3,(H,17,18);2*1H |
| InChIKey | HOFRMLCEWFGDSO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |