C13H16INO4 — CID 53239315
(2S,5S)-2-amino-5-[(4-iodophenyl)methyl]hexanedioic acid (PubChem CID 53239315) has the molecular formula C13H16INO4 and a molecular weight of 375.18 g/mol. Its IUPAC name is (2S,5S)-2-amino-5-[(4-iodophenyl)methyl]hexanedioic acid.
| Compound Name | (2S,5S)-2-amino-5-[(4-iodophenyl)methyl]hexanedioic acid |
|---|---|
| PubChem CID | 53239315 |
| Molecular Formula | C13H16INO4 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | (2S,5S)-2-amino-5-[(4-iodophenyl)methyl]hexanedioic acid |
| SMILES | N[C@@H](CC[C@@H](Cc1ccc([125I])cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H16INO4/c14-10-4-1-8(2-5-10)7-9(12(16)17)3-6-11(15)13(18)19/h1-2,4-5,9,11H,3,6-7,15H2,(H,16,17)(H,18,19)/t9-,11-/m0/s1/i14-2 |
| InChIKey | XHQCSIMWHMZZMC-PBSMCILXSA-N |
| XLogP | 1.73 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|