C20H31Cl2N3O — CID 169043201
N-[5-[[4-[bis(2-chloroethyl)amino]phenyl]methylamino]pentyl]-2-methylprop-2-enamide (PubChem CID 169043201) has the molecular formula C20H31Cl2N3O and a molecular weight of 400.39 g/mol. Its IUPAC name is N-[5-[[4-[bis(2-chloroethyl)amino]phenyl]methylamino]pentyl]-2-methylprop-2-enamide.
| Compound Name | N-[5-[[4-[bis(2-chloroethyl)amino]phenyl]methylamino]pentyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 169043201 |
| Molecular Formula | C20H31Cl2N3O |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-[5-[[4-[bis(2-chloroethyl)amino]phenyl]methylamino]pentyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCNCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C20H31Cl2N3O/c1-17(2)20(26)24-13-5-3-4-12-23-16-18-6-8-19(9-7-18)25(14-10-21)15-11-22/h6-9,23H,1,3-5,10-16H2,2H3,(H,24,26) |
| InChIKey | IHJBVVUFLGXXRN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|