C13H18N2O3S — CID 167281604
4-[[2-(2-methylprop-2-enoylamino)ethylamino]methyl]benzenesulfinic acid (PubChem CID 167281604) has the molecular formula C13H18N2O3S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-[[2-(2-methylprop-2-enoylamino)ethylamino]methyl]benzenesulfinic acid.
| Compound Name | 4-[[2-(2-methylprop-2-enoylamino)ethylamino]methyl]benzenesulfinic acid |
|---|---|
| PubChem CID | 167281604 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-[[2-(2-methylprop-2-enoylamino)ethylamino]methyl]benzenesulfinic acid |
| SMILES | C=C(C)C(=O)NCCNCc1ccc(S(=O)O)cc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-10(2)13(16)15-8-7-14-9-11-3-5-12(6-4-11)19(17)18/h3-6,14H,1,7-9H2,2H3,(H,15,16)(H,17,18) |
| InChIKey | JOOPBMJQHHGAOW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|