C16H25BN2O2 — CID 177314773
[4-[[2-[[(3E)-2-methylhexa-1,3-dien-3-yl]amino]ethylamino]methyl]phenyl]boronic acid (PubChem CID 177314773) has the molecular formula C16H25BN2O2 and a molecular weight of 288.20 g/mol. Its IUPAC name is [4-[[2-[[(3E)-2-methylhexa-1,3-dien-3-yl]amino]ethylamino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[2-[[(3E)-2-methylhexa-1,3-dien-3-yl]amino]ethylamino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 177314773 |
| Molecular Formula | C16H25BN2O2 |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | [4-[[2-[[(3E)-2-methylhexa-1,3-dien-3-yl]amino]ethylamino]methyl]phenyl]boronic acid |
| SMILES | C=C(C)/C(=C\CC)NCCNCc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C16H25BN2O2/c1-4-5-16(13(2)3)19-11-10-18-12-14-6-8-15(9-7-14)17(20)21/h5-9,18-21H,2,4,10-12H2,1,3H3/b16-5+ |
| InChIKey | SHQGGKFPGVNBKA-FZSIALSZSA-N |
| XLogP | 0.92 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|