C32H54Cl2N4O6 — CID 169043223
N-[2-[2-[[4-[bis(2-chloroethyl)amino]phenyl]methylamino]ethyl-methylamino]ethyl]-3-[2-[2-[2-(5-methyl-4-oxohex-5-enoxy)ethoxy]ethoxy]ethoxy]propanamide (PubChem CID 169043223) has the molecular formula C32H54Cl2N4O6 and a molecular weight of 661.71 g/mol. Its IUPAC name is N-[2-[2-[[4-[bis(2-chloroethyl)amino]phenyl]methylamino]ethyl-methylamino]ethyl]-3-[2-[2-[2-(5-methyl-4-oxohex-5-enoxy)ethoxy]ethoxy]ethoxy]propanamide.
| Compound Name | N-[2-[2-[[4-[bis(2-chloroethyl)amino]phenyl]methylamino]ethyl-methylamino]ethyl]-3-[2-[2-[2-(5-methyl-4-oxohex-5-enoxy)ethoxy]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 169043223 |
| Molecular Formula | C32H54Cl2N4O6 |
| Molecular Weight | 661.71 g/mol |
| Exact Mass | 660.34 |
| IUPAC Name | N-[2-[2-[[4-[bis(2-chloroethyl)amino]phenyl]methylamino]ethyl-methylamino]ethyl]-3-[2-[2-[2-(5-methyl-4-oxohex-5-enoxy)ethoxy]ethoxy]ethoxy]propanamide |
| SMILES | C=C(C)C(=O)CCCOCCOCCOCCOCCC(=O)NCCN(C)CCNCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C32H54Cl2N4O6/c1-28(2)31(39)5-4-19-41-21-23-43-25-26-44-24-22-42-20-10-32(40)36-14-18-37(3)17-13-35-27-29-6-8-30(9-7-29)38(15-11-33)16-12-34/h6-9,35H,1,4-5,10-27H2,2-3H3,(H,36,40) |
| InChIKey | JMLXFSQMVJHRLS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|