C16H22Cl3NO2 — CID 3024105
2-chloroethyl 2-[4-[bis(2-chloroethyl)amino]phenyl]butanoate (PubChem CID 3024105) has the molecular formula C16H22Cl3NO2 and a molecular weight of 366.72 g/mol. Its IUPAC name is 2-chloroethyl 2-[4-[bis(2-chloroethyl)amino]phenyl]butanoate.
| Compound Name | 2-chloroethyl 2-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 3024105 |
| Molecular Formula | C16H22Cl3NO2 |
| Molecular Weight | 366.72 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-chloroethyl 2-[4-[bis(2-chloroethyl)amino]phenyl]butanoate |
| SMILES | CCC(C(=O)OCCCl)c1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C16H22Cl3NO2/c1-2-15(16(21)22-12-9-19)13-3-5-14(6-4-13)20(10-7-17)11-8-18/h3-6,15H,2,7-12H2,1H3 |
| InChIKey | PLTCGKKEIOBQDM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|