C27H35ClN4O4S — CID 22219133
N-[1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-(N-methylsulfonylanilino)butanamide;hydrochloride (PubChem CID 22219133) has the molecular formula C27H35ClN4O4S and a molecular weight of 547.12 g/mol. Its IUPAC name is N-[1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-(N-methylsulfonylanilino)butanamide;hydrochloride.
| Compound Name | N-[1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-(N-methylsulfonylanilino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 22219133 |
| Molecular Formula | C27H35ClN4O4S |
| Molecular Weight | 547.12 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | N-[1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-(N-methylsulfonylanilino)butanamide;hydrochloride |
| SMILES | CS(=O)(=O)N(CCCC(=O)NC(Cc1ccc2ccccc2c1)C(=O)NCCCN)c1ccccc1.Cl |
| InChI | InChI=1S/C27H34N4O4S.ClH/c1-36(34,35)31(24-11-3-2-4-12-24)18-7-13-26(32)30-25(27(33)29-17-8-16-28)20-21-14-15-22-9-5-6-10-23(22)19-21;/h2-6,9-12,14-15,19,25H,7-8,13,16-18,20,28H2,1H3,(H,29,33)(H,30,32);1H |
| InChIKey | FGEJWBYCGVAEJW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.12 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|