C37H43ClN4O5 — CID 11983535
methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-phenanthren-9-ylphenyl)propanoyl]amino]-6-aminohexanoyl]amino]pent-4-enoate;hydrochloride (PubChem CID 11983535) has the molecular formula C37H43ClN4O5 and a molecular weight of 659.23 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-phenanthren-9-ylphenyl)propanoyl]amino]-6-aminohexanoyl]amino]pent-4-enoate;hydrochloride.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-phenanthren-9-ylphenyl)propanoyl]amino]-6-aminohexanoyl]amino]pent-4-enoate;hydrochloride |
|---|---|
| PubChem CID | 11983535 |
| Molecular Formula | C37H43ClN4O5 |
| Molecular Weight | 659.23 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-(4-phenanthren-9-ylphenyl)propanoyl]amino]-6-aminohexanoyl]amino]pent-4-enoate;hydrochloride |
| SMILES | C=CC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccc(-c2cc3ccccc3c3ccccc23)cc1)NC(C)=O)C(=O)OC.Cl |
| InChI | InChI=1S/C37H42N4O5.ClH/c1-4-11-33(37(45)46-3)41-35(43)32(16-9-10-21-38)40-36(44)34(39-24(2)42)22-25-17-19-26(20-18-25)31-23-27-12-5-6-13-28(27)29-14-7-8-15-30(29)31;/h4-8,12-15,17-20,23,32-34H,1,9-11,16,21-22,38H2,2-3H3,(H,39,42)(H,40,44)(H,41,43);1H/t32-,33-,34-;/m0./s1 |
| InChIKey | OFXGHEPUCHNLIM-QWBWAIGJSA-N |
| XLogP | 4.98 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.23 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|