C39H45N3O6 — CID 44573974
methyl (2R)-2-[[(2R)-6-amino-2-[4-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxybutanoylamino]hexanoyl]amino]pent-4-enoate (PubChem CID 44573974) has the molecular formula C39H45N3O6 and a molecular weight of 651.80 g/mol. Its IUPAC name is methyl (2R)-2-[[(2R)-6-amino-2-[4-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxybutanoylamino]hexanoyl]amino]pent-4-enoate.
| Compound Name | methyl (2R)-2-[[(2R)-6-amino-2-[4-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxybutanoylamino]hexanoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 44573974 |
| Molecular Formula | C39H45N3O6 |
| Molecular Weight | 651.80 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | methyl (2R)-2-[[(2R)-6-amino-2-[4-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxybutanoylamino]hexanoyl]amino]pent-4-enoate |
| SMILES | C=CCOc1ccc2ccccc2c1-c1c(OCCCC(=O)N[C@H](CCCCN)C(=O)N[C@H](CC=C)C(=O)OC)ccc2ccccc12 |
| InChI | InChI=1S/C39H45N3O6/c1-4-13-32(39(45)46-3)42-38(44)31(18-10-11-24-40)41-35(43)19-12-26-48-34-23-21-28-15-7-9-17-30(28)37(34)36-29-16-8-6-14-27(29)20-22-33(36)47-25-5-2/h4-9,14-17,20-23,31-32H,1-2,10-13,18-19,24-26,40H2,3H3,(H,41,43)(H,42,44)/t31-,32-/m1/s1 |
| InChIKey | VCQZHCCGMACPBQ-ROJLCIKYSA-N |
| XLogP | 6.23 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.80 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|