C38H37N3O6 — CID 59860590
methyl 3-[[(2R)-5-amino-2-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]pentanoyl]amino]benzoate (PubChem CID 59860590) has the molecular formula C38H37N3O6 and a molecular weight of 631.73 g/mol. Its IUPAC name is methyl 3-[[(2R)-5-amino-2-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]pentanoyl]amino]benzoate.
| Compound Name | methyl 3-[[(2R)-5-amino-2-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]pentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 59860590 |
| Molecular Formula | C38H37N3O6 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | methyl 3-[[(2R)-5-amino-2-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]pentanoyl]amino]benzoate |
| SMILES | C=CCOc1ccc2ccccc2c1-c1c(OCC(=O)N[C@H](CCCN)C(=O)Nc2cccc(C(=O)OC)c2)ccc2ccccc12 |
| InChI | InChI=1S/C38H37N3O6/c1-3-22-46-32-19-17-25-10-4-6-14-29(25)35(32)36-30-15-7-5-11-26(30)18-20-33(36)47-24-34(42)41-31(16-9-21-39)37(43)40-28-13-8-12-27(23-28)38(44)45-2/h3-8,10-15,17-20,23,31H,1,9,16,21-22,24,39H2,2H3,(H,40,43)(H,41,42)/t31-/m1/s1 |
| InChIKey | JVNMVZWSHJOULF-WJOKGBTCSA-N |
| XLogP | 6.25 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|