C39H43N5O6 — CID 89386322
methyl (2S)-2-[[(2R)-6-[[amino-(methylideneamino)methylidene]amino]-2-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]hexanoyl]amino]pent-4-enoate (PubChem CID 89386322) has the molecular formula C39H43N5O6 and a molecular weight of 677.80 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R)-6-[[amino-(methylideneamino)methylidene]amino]-2-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]hexanoyl]amino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[(2R)-6-[[amino-(methylideneamino)methylidene]amino]-2-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]hexanoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 89386322 |
| Molecular Formula | C39H43N5O6 |
| Molecular Weight | 677.80 g/mol |
| Exact Mass | 677.32 |
| IUPAC Name | methyl (2S)-2-[[(2R)-6-[[amino-(methylideneamino)methylidene]amino]-2-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]hexanoyl]amino]pent-4-enoate |
| SMILES | C=CCOc1ccc2ccccc2c1-c1c(OCC(=O)N[C@H](CCCC/N=C(/N)N=C)C(=O)N[C@@H](CC=C)C(=O)OC)ccc2ccccc12 |
| InChI | InChI=1S/C39H43N5O6/c1-5-13-31(38(47)48-4)44-37(46)30(18-11-12-23-42-39(40)41-3)43-34(45)25-50-33-22-20-27-15-8-10-17-29(27)36(33)35-28-16-9-7-14-26(28)19-21-32(35)49-24-6-2/h5-10,14-17,19-22,30-31H,1-3,11-13,18,23-25H2,4H3,(H2,40,42)(H,43,45)(H,44,46)/t30-,31+/m1/s1 |
| InChIKey | SCYOIUWDHDCAJF-JSOSNVBQSA-N |
| XLogP | 5.51 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.80 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|