C45H44N5O6+ — CID 135985620
diaminomethylidene-[(4R)-5-oxo-5-(3-phenylmethoxycarbonylanilino)-4-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]pentyl]azanium (PubChem CID 135985620) has the molecular formula C45H44N5O6+ and a molecular weight of 750.88 g/mol. Its IUPAC name is diaminomethylidene-[(4R)-5-oxo-5-(3-phenylmethoxycarbonylanilino)-4-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]pentyl]azanium.
| Compound Name | diaminomethylidene-[(4R)-5-oxo-5-(3-phenylmethoxycarbonylanilino)-4-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]pentyl]azanium |
|---|---|
| PubChem CID | 135985620 |
| Molecular Formula | C45H44N5O6+ |
| Molecular Weight | 750.88 g/mol |
| Exact Mass | 750.33 |
| IUPAC Name | diaminomethylidene-[(4R)-5-oxo-5-(3-phenylmethoxycarbonylanilino)-4-[[2-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxyacetyl]amino]pentyl]azanium |
| SMILES | C=CCOc1ccc2ccccc2c1-c1c(OCC(=O)N[C@H](CCC[NH+]=C(N)N)C(=O)Nc2cccc(C(=O)OCc3ccccc3)c2)ccc2ccccc12 |
| InChI | InChI=1S/C45H43N5O6/c1-2-26-54-38-23-21-31-14-6-8-18-35(31)41(38)42-36-19-9-7-15-32(36)22-24-39(42)55-29-40(51)50-37(20-11-25-48-45(46)47)43(52)49-34-17-10-16-33(27-34)44(53)56-28-30-12-4-3-5-13-30/h2-10,12-19,21-24,27,37H,1,11,20,25-26,28-29H2,(H,49,52)(H,50,51)(H4,46,47,48)/p+1/t37-/m1/s1 |
| InChIKey | QLBFUNMOXSDUCA-DIPNUNPCSA-O |
| XLogP | 5.22 |
| TPSA | 168.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.88 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|