C27H39ClN6O7 — CID 163625147
methyl (2S)-2-[[(2S)-6-[[amino-(chloroamino)methylidene]amino]-2-[[(2S)-2-(methoxycarbonylamino)-3-(4-prop-2-enoxyphenyl)propanoyl]amino]hexanoyl]amino]pent-4-enoate (PubChem CID 163625147) has the molecular formula C27H39ClN6O7 and a molecular weight of 595.10 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-6-[[amino-(chloroamino)methylidene]amino]-2-[[(2S)-2-(methoxycarbonylamino)-3-(4-prop-2-enoxyphenyl)propanoyl]amino]hexanoyl]amino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[(2S)-6-[[amino-(chloroamino)methylidene]amino]-2-[[(2S)-2-(methoxycarbonylamino)-3-(4-prop-2-enoxyphenyl)propanoyl]amino]hexanoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 163625147 |
| Molecular Formula | C27H39ClN6O7 |
| Molecular Weight | 595.10 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | methyl (2S)-2-[[(2S)-6-[[amino-(chloroamino)methylidene]amino]-2-[[(2S)-2-(methoxycarbonylamino)-3-(4-prop-2-enoxyphenyl)propanoyl]amino]hexanoyl]amino]pent-4-enoate |
| SMILES | C=CCOc1ccc(C[C@H](NC(=O)OC)C(=O)N[C@@H](CCCC/N=C(\N)NCl)C(=O)N[C@@H](CC=C)C(=O)OC)cc1 |
| InChI | InChI=1S/C27H39ClN6O7/c1-5-9-21(25(37)39-3)32-23(35)20(10-7-8-15-30-26(29)34-28)31-24(36)22(33-27(38)40-4)17-18-11-13-19(14-12-18)41-16-6-2/h5-6,11-14,20-22H,1-2,7-10,15-17H2,3-4H3,(H,31,36)(H,32,35)(H,33,38)(H3,29,30,34)/t20-,21-,22-/m0/s1 |
| InChIKey | HRJQQAUPLSSQGR-FKBYEOEOSA-N |
| XLogP | 1.47 |
| TPSA | 182.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.10 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|