C28H42ClN5O7 — CID 158572545
diaminomethylidene-[(5R,8S)-8-(methoxycarbonylamino)-5-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]carbamoyl]-7-oxo-9-(4-prop-2-enoxyphenyl)nonyl]azanium chloride (PubChem CID 158572545) has the molecular formula C28H42ClN5O7 and a molecular weight of 596.13 g/mol. Its IUPAC name is diaminomethylidene-[(5R,8S)-8-(methoxycarbonylamino)-5-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]carbamoyl]-7-oxo-9-(4-prop-2-enoxyphenyl)nonyl]azanium chloride.
| Compound Name | diaminomethylidene-[(5R,8S)-8-(methoxycarbonylamino)-5-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]carbamoyl]-7-oxo-9-(4-prop-2-enoxyphenyl)nonyl]azanium chloride |
|---|---|
| PubChem CID | 158572545 |
| Molecular Formula | C28H42ClN5O7 |
| Molecular Weight | 596.13 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | diaminomethylidene-[(5R,8S)-8-(methoxycarbonylamino)-5-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]carbamoyl]-7-oxo-9-(4-prop-2-enoxyphenyl)nonyl]azanium chloride |
| SMILES | C=CCOc1ccc(C[C@H](NC(=O)OC)C(=O)C[C@@H](CCCC[NH+]=C(N)N)C(=O)N[C@@H](CC=C)C(=O)OC)cc1.[Cl-] |
| InChI | InChI=1S/C28H41N5O7.ClH/c1-5-9-22(26(36)38-3)32-25(35)20(10-7-8-15-31-27(29)30)18-24(34)23(33-28(37)39-4)17-19-11-13-21(14-12-19)40-16-6-2;/h5-6,11-14,20,22-23H,1-2,7-10,15-18H2,3-4H3,(H,32,35)(H,33,37)(H4,29,30,31);1H/t20-,22+,23+;/m1./s1 |
| InChIKey | XATWBKMJEDOUGR-LAHGGVGVSA-N |
| XLogP | -3.14 |
| TPSA | 186.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.13 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|