C28H35ClN4O5 — CID 160715436
diaminomethylidene-[(4S)-6-(9H-fluoren-9-ylmethoxy)-4-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]carbamoyl]-6-oxohexyl]azanium chloride (PubChem CID 160715436) has the molecular formula C28H35ClN4O5 and a molecular weight of 543.06 g/mol. Its IUPAC name is diaminomethylidene-[(4S)-6-(9H-fluoren-9-ylmethoxy)-4-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]carbamoyl]-6-oxohexyl]azanium chloride.
| Compound Name | diaminomethylidene-[(4S)-6-(9H-fluoren-9-ylmethoxy)-4-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]carbamoyl]-6-oxohexyl]azanium chloride |
|---|---|
| PubChem CID | 160715436 |
| Molecular Formula | C28H35ClN4O5 |
| Molecular Weight | 543.06 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | diaminomethylidene-[(4S)-6-(9H-fluoren-9-ylmethoxy)-4-[[(2S)-1-methoxy-1-oxopent-4-en-2-yl]carbamoyl]-6-oxohexyl]azanium chloride |
| SMILES | C=CC[C@H](NC(=O)[C@@H](CCC[NH+]=C(N)N)CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC.[Cl-] |
| InChI | InChI=1S/C28H34N4O5.ClH/c1-3-9-24(27(35)36-2)32-26(34)18(10-8-15-31-28(29)30)16-25(33)37-17-23-21-13-6-4-11-19(21)20-12-5-7-14-22(20)23;/h3-7,11-14,18,23-24H,1,8-10,15-17H2,2H3,(H,32,34)(H4,29,30,31);1H/t18-,24-;/m0./s1 |
| InChIKey | JKCFBERSRCWRKV-GZAZCRCBSA-N |
| XLogP | -2.28 |
| TPSA | 147.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.06 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|