C21H21NO4 — CID 53444995
3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)hex-5-enoic acid (PubChem CID 53444995) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)hex-5-enoic acid.
| Compound Name | 3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)hex-5-enoic acid |
|---|---|
| PubChem CID | 53444995 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)hex-5-enoic acid |
| SMILES | C=CCC(N)C(C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H21NO4/c1-2-7-18(22)19(20(23)24)21(25)26-12-17-15-10-5-3-8-13(15)14-9-4-6-11-16(14)17/h2-6,8-11,17-19H,1,7,12,22H2,(H,23,24) |
| InChIKey | QTXGYCSWOPTKNC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|