C25H22INO4 — CID 53444975
3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(4-iodophenyl)butanoic acid (PubChem CID 53444975) has the molecular formula C25H22INO4 and a molecular weight of 527.36 g/mol. Its IUPAC name is 3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(4-iodophenyl)butanoic acid.
| Compound Name | 3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(4-iodophenyl)butanoic acid |
|---|---|
| PubChem CID | 53444975 |
| Molecular Formula | C25H22INO4 |
| Molecular Weight | 527.36 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | 3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-4-(4-iodophenyl)butanoic acid |
| SMILES | NC(Cc1ccc(I)cc1)C(C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22INO4/c26-16-11-9-15(10-12-16)13-22(27)23(24(28)29)25(30)31-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-23H,13-14,27H2,(H,28,29) |
| InChIKey | QFQZHMVQKBTEPW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|