C34H40ClN5O6 — CID 140532342
diaminomethylidene-[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[(2S)-1-methoxy-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]amino]-5-oxopentyl]azanium chloride (PubChem CID 140532342) has the molecular formula C34H40ClN5O6 and a molecular weight of 650.18 g/mol. Its IUPAC name is diaminomethylidene-[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[(2S)-1-methoxy-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]amino]-5-oxopentyl]azanium chloride.
| Compound Name | diaminomethylidene-[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[(2S)-1-methoxy-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]amino]-5-oxopentyl]azanium chloride |
|---|---|
| PubChem CID | 140532342 |
| Molecular Formula | C34H40ClN5O6 |
| Molecular Weight | 650.18 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | diaminomethylidene-[(4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[[(2S)-1-methoxy-1-oxo-3-(4-prop-2-enoxyphenyl)propan-2-yl]amino]-5-oxopentyl]azanium chloride |
| SMILES | C=CCOc1ccc(C[C@H](NC(=O)[C@H](CCC[NH+]=C(N)N)NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC)cc1.[Cl-] |
| InChI | InChI=1S/C34H39N5O6.ClH/c1-3-19-44-23-16-14-22(15-17-23)20-30(32(41)43-2)38-31(40)29(13-8-18-37-33(35)36)39-34(42)45-21-28-26-11-6-4-9-24(26)25-10-5-7-12-27(25)28;/h3-7,9-12,14-17,28-30H,1,8,13,18-21H2,2H3,(H,38,40)(H,39,42)(H4,35,36,37);1H/t29-,30-;/m0./s1 |
| InChIKey | YGVYFPZQPUHQSH-PNHSAAKESA-N |
| XLogP | -1.50 |
| TPSA | 168.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.18 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|