C40H49N3O8 — CID 143260006
methyl 2-[[(2R)-2-[(1-methyl-9H-fluoren-9-yl)methoxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate (PubChem CID 143260006) has the molecular formula C40H49N3O8 and a molecular weight of 699.85 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-[(1-methyl-9H-fluoren-9-yl)methoxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate.
| Compound Name | methyl 2-[[(2R)-2-[(1-methyl-9H-fluoren-9-yl)methoxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate |
|---|---|
| PubChem CID | 143260006 |
| Molecular Formula | C40H49N3O8 |
| Molecular Weight | 699.85 g/mol |
| Exact Mass | 699.35 |
| IUPAC Name | methyl 2-[[(2R)-2-[(1-methyl-9H-fluoren-9-yl)methoxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(4-prop-2-enoxyphenyl)propanoate |
| SMILES | C=CCOc1ccc(CC(NC(=O)[C@@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OCC2c3ccccc3-c3cccc(C)c32)C(=O)OC)cc1 |
| InChI | InChI=1S/C40H49N3O8/c1-7-23-49-28-20-18-27(19-21-28)24-34(37(45)48-6)42-36(44)33(17-10-11-22-41-38(46)51-40(3,4)5)43-39(47)50-25-32-30-15-9-8-14-29(30)31-16-12-13-26(2)35(31)32/h7-9,12-16,18-21,32-34H,1,10-11,17,22-25H2,2-6H3,(H,41,46)(H,42,44)(H,43,47)/t32?,33-,34?/m1/s1 |
| InChIKey | DJGFSNLXWQCZPV-QVGGVDQBSA-N |
| XLogP | 6.36 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.85 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|