C38H44N4O7 — CID 69230873
methyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 69230873) has the molecular formula C38H44N4O7 and a molecular weight of 668.79 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 69230873 |
| Molecular Formula | C38H44N4O7 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H44N4O7/c1-38(2,3)49-36(45)39-20-12-11-19-32(34(43)41-33(35(44)47-4)21-24-22-40-31-18-10-9-13-25(24)31)42-37(46)48-23-30-28-16-7-5-14-26(28)27-15-6-8-17-29(27)30/h5-10,13-18,22,30,32-33,40H,11-12,19-21,23H2,1-4H3,(H,39,45)(H,41,43)(H,42,46)/t32-,33-/m0/s1 |
| InChIKey | NNMXQNHSSIRGQJ-LQJZCPKCSA-N |
| XLogP | 5.97 |
| TPSA | 147.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|