C27H40N3O6+ — CID 58560159
[(5R,8S)-8-acetamido-5-[[(2S)-1-formyloxypent-4-en-2-yl]carbamoyl]-7-oxo-9-(4-prop-2-enoxyphenyl)nonyl]azanium (PubChem CID 58560159) has the molecular formula C27H40N3O6+ and a molecular weight of 502.63 g/mol. Its IUPAC name is [(5R,8S)-8-acetamido-5-[[(2S)-1-formyloxypent-4-en-2-yl]carbamoyl]-7-oxo-9-(4-prop-2-enoxyphenyl)nonyl]azanium.
| Compound Name | [(5R,8S)-8-acetamido-5-[[(2S)-1-formyloxypent-4-en-2-yl]carbamoyl]-7-oxo-9-(4-prop-2-enoxyphenyl)nonyl]azanium |
|---|---|
| PubChem CID | 58560159 |
| Molecular Formula | C27H40N3O6+ |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | [(5R,8S)-8-acetamido-5-[[(2S)-1-formyloxypent-4-en-2-yl]carbamoyl]-7-oxo-9-(4-prop-2-enoxyphenyl)nonyl]azanium |
| SMILES | C=CCOc1ccc(C[C@H](NC(C)=O)C(=O)C[C@@H](CCCC[NH3+])C(=O)N[C@@H](CC=C)COC=O)cc1 |
| InChI | InChI=1S/C27H39N3O6/c1-4-8-23(18-35-19-31)30-27(34)22(9-6-7-14-28)17-26(33)25(29-20(3)32)16-21-10-12-24(13-11-21)36-15-5-2/h4-5,10-13,19,22-23,25H,1-2,6-9,14-18,28H2,3H3,(H,29,32)(H,30,34)/p+1/t22-,23+,25+/m1/s1 |
| InChIKey | LHIIYFRXGFOATA-CUYJMHBOSA-O |
| XLogP | 1.52 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|