C32H46N4O8 — CID 89363070
methyl (3S)-3-[[(E)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoyl]amino]hex-5-enoate (PubChem CID 89363070) has the molecular formula C32H46N4O8 and a molecular weight of 614.74 g/mol. Its IUPAC name is methyl (3S)-3-[[(E)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoyl]amino]hex-5-enoate.
| Compound Name | methyl (3S)-3-[[(E)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoyl]amino]hex-5-enoate |
|---|---|
| PubChem CID | 89363070 |
| Molecular Formula | C32H46N4O8 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | methyl (3S)-3-[[(E)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-2-enoyl]amino]hex-5-enoate |
| SMILES | C=CCOc1ccc(C[C@H](NC(C)=O)C(=O)N/C(=C/CCCNC(=O)OC(C)(C)C)C(=O)N[C@@H](CC=C)CC(=O)OC)cc1 |
| InChI | InChI=1S/C32H46N4O8/c1-8-12-24(21-28(38)42-7)35-29(39)26(13-10-11-18-33-31(41)44-32(4,5)6)36-30(40)27(34-22(3)37)20-23-14-16-25(17-15-23)43-19-9-2/h8-9,13-17,24,27H,1-2,10-12,18-21H2,3-7H3,(H,33,41)(H,34,37)(H,35,39)(H,36,40)/b26-13+/t24-,27-/m0/s1 |
| InChIKey | WAHMYUZGHRZKOR-VJNUPVECSA-N |
| XLogP | 3.23 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|