C28H40N6O6 — CID 89363019
methyl (3S)-3-[[(E)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-(diaminomethylideneamino)hex-2-enoyl]amino]hex-5-enoate (PubChem CID 89363019) has the molecular formula C28H40N6O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is methyl (3S)-3-[[(E)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-(diaminomethylideneamino)hex-2-enoyl]amino]hex-5-enoate.
| Compound Name | methyl (3S)-3-[[(E)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-(diaminomethylideneamino)hex-2-enoyl]amino]hex-5-enoate |
|---|---|
| PubChem CID | 89363019 |
| Molecular Formula | C28H40N6O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | methyl (3S)-3-[[(E)-2-[[(2S)-2-acetamido-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-6-(diaminomethylideneamino)hex-2-enoyl]amino]hex-5-enoate |
| SMILES | C=CCOc1ccc(C[C@H](NC(C)=O)C(=O)N/C(=C/CCCN=C(N)N)C(=O)N[C@@H](CC=C)CC(=O)OC)cc1 |
| InChI | InChI=1S/C28H40N6O6/c1-5-9-21(18-25(36)39-4)33-26(37)23(10-7-8-15-31-28(29)30)34-27(38)24(32-19(3)35)17-20-11-13-22(14-12-20)40-16-6-2/h5-6,10-14,21,24H,1-2,7-9,15-18H2,3-4H3,(H,32,35)(H,33,37)(H,34,38)(H4,29,30,31)/b23-10+/t21-,24-/m0/s1 |
| InChIKey | PGEFNECTNPACQX-CMOMETPHSA-N |
| XLogP | 0.98 |
| TPSA | 187.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|