C27H44N6O6 — CID 142199976
methyl 2-[[2-[(2-acetamidoacetyl)amino]-6-(diaminomethylideneamino)hexanoyl]amino]acetate;1-methyl-4-prop-2-enoxybenzene;prop-1-ene (PubChem CID 142199976) has the molecular formula C27H44N6O6 and a molecular weight of 548.69 g/mol. Its IUPAC name is methyl 2-[[2-[(2-acetamidoacetyl)amino]-6-(diaminomethylideneamino)hexanoyl]amino]acetate;1-methyl-4-prop-2-enoxybenzene;prop-1-ene.
| Compound Name | methyl 2-[[2-[(2-acetamidoacetyl)amino]-6-(diaminomethylideneamino)hexanoyl]amino]acetate;1-methyl-4-prop-2-enoxybenzene;prop-1-ene |
|---|---|
| PubChem CID | 142199976 |
| Molecular Formula | C27H44N6O6 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | methyl 2-[[2-[(2-acetamidoacetyl)amino]-6-(diaminomethylideneamino)hexanoyl]amino]acetate;1-methyl-4-prop-2-enoxybenzene;prop-1-ene |
| SMILES | C=CC.C=CCOc1ccc(C)cc1.COC(=O)CNC(=O)C(CCCCN=C(N)N)NC(=O)CNC(C)=O |
| InChI | InChI=1S/C14H26N6O5.C10H12O.C3H6/c1-9(21)18-7-11(22)20-10(5-3-4-6-17-14(15)16)13(24)19-8-12(23)25-2;1-3-8-11-10-6-4-9(2)5-7-10;1-3-2/h10H,3-8H2,1-2H3,(H,18,21)(H,19,24)(H,20,22)(H4,15,16,17);3-7H,1,8H2,2H3;3H,1H2,2H3 |
| InChIKey | SJMVGRHXXNJOJF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 187.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|