C39H39ClN2O6 — CID 158101891
azane;[3-[[(2S)-2-(3-chloropropyl)-4-oxo-5-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxypentanoyl]amino]phenyl]methyl formate (PubChem CID 158101891) has the molecular formula C39H39ClN2O6 and a molecular weight of 667.20 g/mol. Its IUPAC name is azane;[3-[[(2S)-2-(3-chloropropyl)-4-oxo-5-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxypentanoyl]amino]phenyl]methyl formate.
| Compound Name | azane;[3-[[(2S)-2-(3-chloropropyl)-4-oxo-5-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxypentanoyl]amino]phenyl]methyl formate |
|---|---|
| PubChem CID | 158101891 |
| Molecular Formula | C39H39ClN2O6 |
| Molecular Weight | 667.20 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | azane;[3-[[(2S)-2-(3-chloropropyl)-4-oxo-5-[1-(2-prop-2-enoxynaphthalen-1-yl)naphthalen-2-yl]oxypentanoyl]amino]phenyl]methyl formate |
| SMILES | C=CCOc1ccc2ccccc2c1-c1c(OCC(=O)C[C@H](CCCCl)C(=O)Nc2cccc(COC=O)c2)ccc2ccccc12.N |
| InChI | InChI=1S/C39H36ClNO6.H3N/c1-2-21-46-35-18-16-28-10-3-5-14-33(28)37(35)38-34-15-6-4-11-29(34)17-19-36(38)47-25-32(43)23-30(12-8-20-40)39(44)41-31-13-7-9-27(22-31)24-45-26-42;/h2-7,9-11,13-19,22,26,30H,1,8,12,20-21,23-25H2,(H,41,44);1H3/t30-;/m0./s1 |
| InChIKey | UZPNIWOEIQDBBX-CZCBIWLKSA-N |
| XLogP | 8.67 |
| TPSA | 125.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.20 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|