C36H28N2O4 — CID 58058387
1-[3-[[1-(3-formyl-2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxymethyl]phenyl]-3-(4-methylphenyl)urea (PubChem CID 58058387) has the molecular formula C36H28N2O4 and a molecular weight of 552.63 g/mol. Its IUPAC name is 1-[3-[[1-(3-formyl-2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxymethyl]phenyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[3-[[1-(3-formyl-2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxymethyl]phenyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 58058387 |
| Molecular Formula | C36H28N2O4 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 1-[3-[[1-(3-formyl-2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxymethyl]phenyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc(COc3ccc4ccccc4c3-c3c(O)c(C=O)cc4ccccc34)c2)cc1 |
| InChI | InChI=1S/C36H28N2O4/c1-23-13-16-28(17-14-23)37-36(41)38-29-10-6-7-24(19-29)22-42-32-18-15-25-8-2-4-11-30(25)33(32)34-31-12-5-3-9-26(31)20-27(21-39)35(34)40/h2-21,40H,22H2,1H3,(H2,37,38,41) |
| InChIKey | KMSUXPCNULTMRW-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|