C33H24N2O4 — CID 102033418
N-[3-[[1-(3-formyl-2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxymethyl]phenyl]-1H-pyrrole-2-carboxamide (PubChem CID 102033418) has the molecular formula C33H24N2O4 and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[3-[[1-(3-formyl-2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxymethyl]phenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[3-[[1-(3-formyl-2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxymethyl]phenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 102033418 |
| Molecular Formula | C33H24N2O4 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | N-[3-[[1-(3-formyl-2-hydroxynaphthalen-1-yl)naphthalen-2-yl]oxymethyl]phenyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=Cc1cc2ccccc2c(-c2c(OCc3cccc(NC(=O)c4ccc[nH]4)c3)ccc3ccccc23)c1O |
| InChI | InChI=1S/C33H24N2O4/c36-19-24-18-23-9-2-4-12-27(23)31(32(24)37)30-26-11-3-1-8-22(26)14-15-29(30)39-20-21-7-5-10-25(17-21)35-33(38)28-13-6-16-34-28/h1-19,34,37H,20H2,(H,35,38) |
| InChIKey | USVUICGNMJZKRZ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|