C38H47N3O6 — CID 142199984
methyl 2-[[(2R)-6-amino-2-[4-[1-(3-ethoxy-7H-benzo[7]annulen-4-yl)naphthalen-2-yl]oxybutanoylamino]hexanoyl]amino]butanoate (PubChem CID 142199984) has the molecular formula C38H47N3O6 and a molecular weight of 641.81 g/mol. Its IUPAC name is methyl 2-[[(2R)-6-amino-2-[4-[1-(3-ethoxy-7H-benzo[7]annulen-4-yl)naphthalen-2-yl]oxybutanoylamino]hexanoyl]amino]butanoate.
| Compound Name | methyl 2-[[(2R)-6-amino-2-[4-[1-(3-ethoxy-7H-benzo[7]annulen-4-yl)naphthalen-2-yl]oxybutanoylamino]hexanoyl]amino]butanoate |
|---|---|
| PubChem CID | 142199984 |
| Molecular Formula | C38H47N3O6 |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 641.35 |
| IUPAC Name | methyl 2-[[(2R)-6-amino-2-[4-[1-(3-ethoxy-7H-benzo[7]annulen-4-yl)naphthalen-2-yl]oxybutanoylamino]hexanoyl]amino]butanoate |
| SMILES | CCOc1ccc2c(c1-c1c(OCCCC(=O)N[C@H](CCCCN)C(=O)NC(CC)C(=O)OC)ccc3ccccc13)C=CCC=C2 |
| InChI | InChI=1S/C38H47N3O6/c1-4-30(38(44)45-3)41-37(43)31(18-11-12-24-39)40-34(42)19-13-25-47-33-23-21-27-15-9-10-17-29(27)36(33)35-28-16-8-6-7-14-26(28)20-22-32(35)46-5-2/h7-10,14-17,20-23,30-31H,4-6,11-13,18-19,24-25,39H2,1-3H3,(H,40,42)(H,41,43)/t30?,31-/m1/s1 |
| InChIKey | ZPMKILRPENRTMW-NLIBRCFJSA-N |
| XLogP | 6.18 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|