C25H43N8O5+ — CID 163441668
[5-amino-4-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]-methylamino]-3-phenylpropanoyl]amino]-5-oxopentyl]-(diaminomethylidene)azanium (PubChem CID 163441668) has the molecular formula C25H43N8O5+ and a molecular weight of 535.67 g/mol. Its IUPAC name is [5-amino-4-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]-methylamino]-3-phenylpropanoyl]amino]-5-oxopentyl]-(diaminomethylidene)azanium.
| Compound Name | [5-amino-4-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]-methylamino]-3-phenylpropanoyl]amino]-5-oxopentyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 163441668 |
| Molecular Formula | C25H43N8O5+ |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | [5-amino-4-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-methylbutanoyl]-methylamino]-3-phenylpropanoyl]amino]-5-oxopentyl]-(diaminomethylidene)azanium |
| SMILES | CC(C)C(NC(=O)C(N)C(C)O)C(=O)N(C)C(Cc1ccccc1)C(=O)NC(CCC[NH+]=C(N)N)C(N)=O |
| InChI | InChI=1S/C25H42N8O5/c1-14(2)20(32-23(37)19(26)15(3)34)24(38)33(4)18(13-16-9-6-5-7-10-16)22(36)31-17(21(27)35)11-8-12-30-25(28)29/h5-7,9-10,14-15,17-20,34H,8,11-13,26H2,1-4H3,(H2,27,35)(H,31,36)(H,32,37)(H4,28,29,30)/p+1 |
| InChIKey | AZBYMGRFHBMJRP-UHFFFAOYSA-O |
| XLogP | -3.99 |
| TPSA | 233.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | -3.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|