C24H34N4O4 — CID 144915173
[(2E)-2-prop-1-en-2-ylpenta-2,4-dienyl] N-[(5S)-6-amino-5-[[(2S)-2-amino-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 144915173) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is [(2E)-2-prop-1-en-2-ylpenta-2,4-dienyl] N-[(5S)-6-amino-5-[[(2S)-2-amino-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | [(2E)-2-prop-1-en-2-ylpenta-2,4-dienyl] N-[(5S)-6-amino-5-[[(2S)-2-amino-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 144915173 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | [(2E)-2-prop-1-en-2-ylpenta-2,4-dienyl] N-[(5S)-6-amino-5-[[(2S)-2-amino-3-phenylpropanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | C=C/C=C(/COC(=O)NCCCC[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(N)=O)C(=C)C |
| InChI | InChI=1S/C24H34N4O4/c1-4-10-19(17(2)3)16-32-24(31)27-14-9-8-13-21(22(26)29)28-23(30)20(25)15-18-11-6-5-7-12-18/h4-7,10-12,20-21H,1-2,8-9,13-16,25H2,3H3,(H2,26,29)(H,27,31)(H,28,30)/b19-10-/t20-,21-/m0/s1 |
| InChIKey | BBZTYIDTMBMUBB-BWFJCAMJSA-N |
| XLogP | 2.11 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|