C30H37F6N7O3S2 — CID 102143977
(2S)-2-[[(2S)-2-acetamido-6-[[4-(trifluoromethyl)phenyl]carbamothioylamino]hexanoyl]amino]-6-[[4-(trifluoromethyl)phenyl]carbamothioylamino]hexanamide (PubChem CID 102143977) has the molecular formula C30H37F6N7O3S2 and a molecular weight of 721.79 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-6-[[4-(trifluoromethyl)phenyl]carbamothioylamino]hexanoyl]amino]-6-[[4-(trifluoromethyl)phenyl]carbamothioylamino]hexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-6-[[4-(trifluoromethyl)phenyl]carbamothioylamino]hexanoyl]amino]-6-[[4-(trifluoromethyl)phenyl]carbamothioylamino]hexanamide |
|---|---|
| PubChem CID | 102143977 |
| Molecular Formula | C30H37F6N7O3S2 |
| Molecular Weight | 721.79 g/mol |
| Exact Mass | 721.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-6-[[4-(trifluoromethyl)phenyl]carbamothioylamino]hexanoyl]amino]-6-[[4-(trifluoromethyl)phenyl]carbamothioylamino]hexanamide |
| SMILES | CC(=O)N[C@@H](CCCCNC(=S)Nc1ccc(C(F)(F)F)cc1)C(=O)N[C@@H](CCCCNC(=S)Nc1ccc(C(F)(F)F)cc1)C(N)=O |
| InChI | InChI=1S/C30H37F6N7O3S2/c1-18(44)40-24(7-3-5-17-39-28(48)42-22-14-10-20(11-15-22)30(34,35)36)26(46)43-23(25(37)45)6-2-4-16-38-27(47)41-21-12-8-19(9-13-21)29(31,32)33/h8-15,23-24H,2-7,16-17H2,1H3,(H2,37,45)(H,40,44)(H,43,46)(H2,38,41,47)(H2,39,42,48)/t23-,24-/m0/s1 |
| InChIKey | FVNFLMJOQCCHOX-ZEQRLZLVSA-N |
| XLogP | 4.81 |
| TPSA | 149.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.79 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|