C27H34F2N4O7P+ — CID 67121678
[[4-[2-acetamido-3-[[1-amino-6-[(4-ethylbenzoyl)amino]-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]-difluoromethoxy]-hydroxy-oxophosphanium (PubChem CID 67121678) has the molecular formula C27H34F2N4O7P+ and a molecular weight of 595.56 g/mol. Its IUPAC name is [[4-[2-acetamido-3-[[1-amino-6-[(4-ethylbenzoyl)amino]-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]-difluoromethoxy]-hydroxy-oxophosphanium.
| Compound Name | [[4-[2-acetamido-3-[[1-amino-6-[(4-ethylbenzoyl)amino]-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]-difluoromethoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 67121678 |
| Molecular Formula | C27H34F2N4O7P+ |
| Molecular Weight | 595.56 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | [[4-[2-acetamido-3-[[1-amino-6-[(4-ethylbenzoyl)amino]-1-oxohexan-2-yl]amino]-3-oxopropyl]phenyl]-difluoromethoxy]-hydroxy-oxophosphanium |
| SMILES | CCc1ccc(C(=O)NCCCCC(NC(=O)C(Cc2ccc(C(F)(F)O[P+](=O)O)cc2)NC(C)=O)C(N)=O)cc1 |
| InChI | InChI=1S/C27H33F2N4O7P/c1-3-18-7-11-20(12-8-18)25(36)31-15-5-4-6-22(24(30)35)33-26(37)23(32-17(2)34)16-19-9-13-21(14-10-19)27(28,29)40-41(38)39/h7-14,22-23H,3-6,15-16H2,1-2H3,(H5-,30,31,32,33,34,35,36,37,38,39)/p+1 |
| InChIKey | OCCPSMDHTRUSKB-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|