C30H39F2N2O7P — CID 162046330
[[4-[2-[[8-[(4-ethylbenzoyl)amino]-3-oxooctan-4-yl]carbamoyl]-4-oxopentyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 162046330) has the molecular formula C30H39F2N2O7P and a molecular weight of 608.62 g/mol. Its IUPAC name is [[4-[2-[[8-[(4-ethylbenzoyl)amino]-3-oxooctan-4-yl]carbamoyl]-4-oxopentyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[2-[[8-[(4-ethylbenzoyl)amino]-3-oxooctan-4-yl]carbamoyl]-4-oxopentyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 162046330 |
| Molecular Formula | C30H39F2N2O7P |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | [[4-[2-[[8-[(4-ethylbenzoyl)amino]-3-oxooctan-4-yl]carbamoyl]-4-oxopentyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CCC(=O)C(CCCCNC(=O)c1ccc(CC)cc1)NC(=O)C(CC(C)=O)Cc1ccc(C(F)(F)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C30H39F2N2O7P/c1-4-21-9-13-23(14-10-21)28(37)33-17-7-6-8-26(27(36)5-2)34-29(38)24(18-20(3)35)19-22-11-15-25(16-12-22)30(31,32)42(39,40)41/h9-16,24,26H,4-8,17-19H2,1-3H3,(H,33,37)(H,34,38)(H2,39,40,41) |
| InChIKey | GAKBRIDIIYWKDO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|