C24H29F3N6O6 — CID 110189158
benzyl N-[(2S)-1-amino-6-[[4-(diaminomethylideneamino)benzoyl]amino]-1-oxohexan-2-yl]carbamate;2,2,2-trifluoroacetic acid (PubChem CID 110189158) has the molecular formula C24H29F3N6O6 and a molecular weight of 554.53 g/mol. Its IUPAC name is benzyl N-[(2S)-1-amino-6-[[4-(diaminomethylideneamino)benzoyl]amino]-1-oxohexan-2-yl]carbamate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl N-[(2S)-1-amino-6-[[4-(diaminomethylideneamino)benzoyl]amino]-1-oxohexan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 110189158 |
| Molecular Formula | C24H29F3N6O6 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | benzyl N-[(2S)-1-amino-6-[[4-(diaminomethylideneamino)benzoyl]amino]-1-oxohexan-2-yl]carbamate;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)[C@H](CCCCNC(=O)c1ccc(N=C(N)N)cc1)NC(=O)OCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N6O4.C2HF3O2/c23-19(29)18(28-22(31)32-14-15-6-2-1-3-7-15)8-4-5-13-26-20(30)16-9-11-17(12-10-16)27-21(24)25;3-2(4,5)1(6)7/h1-3,6-7,9-12,18H,4-5,8,13-14H2,(H2,23,29)(H,26,30)(H,28,31)(H4,24,25,27);(H,6,7)/t18-;/m0./s1 |
| InChIKey | IYELQHSMDIFKQY-FERBBOLQSA-N |
| XLogP | 1.91 |
| TPSA | 212.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|