C24H28F4N4O11P2 — CID 59875004
3-amino-4-[[1-[[1-amino-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 59875004) has the molecular formula C24H28F4N4O11P2 and a molecular weight of 686.45 g/mol. Its IUPAC name is 3-amino-4-[[1-[[1-amino-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[1-amino-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59875004 |
| Molecular Formula | C24H28F4N4O11P2 |
| Molecular Weight | 686.45 g/mol |
| Exact Mass | 686.12 |
| IUPAC Name | 3-amino-4-[[1-[[1-amino-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)NC(=O)C(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)NC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C24H28F4N4O11P2/c25-23(26,44(38,39)40)14-5-1-12(2-6-14)9-17(20(30)35)31-22(37)18(32-21(36)16(29)11-19(33)34)10-13-3-7-15(8-4-13)24(27,28)45(41,42)43/h1-8,16-18H,9-11,29H2,(H2,30,35)(H,31,37)(H,32,36)(H,33,34)(H2,38,39,40)(H2,41,42,43) |
| InChIKey | UUDGQCWBLGYYMH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 279.67 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|