C25H42N3O7PS — CID 10507070
[4-[(2S)-2-acetamido-3-[[(2R)-1-(dipentylamino)-3-methylsulfanyl-1-oxopropan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate (PubChem CID 10507070) has the molecular formula C25H42N3O7PS and a molecular weight of 559.67 g/mol. Its IUPAC name is [4-[(2S)-2-acetamido-3-[[(2R)-1-(dipentylamino)-3-methylsulfanyl-1-oxopropan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[(2S)-2-acetamido-3-[[(2R)-1-(dipentylamino)-3-methylsulfanyl-1-oxopropan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10507070 |
| Molecular Formula | C25H42N3O7PS |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | [4-[(2S)-2-acetamido-3-[[(2R)-1-(dipentylamino)-3-methylsulfanyl-1-oxopropan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H](CSC)NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(C)=O |
| InChI | InChI=1S/C25H42N3O7PS/c1-5-7-9-15-28(16-10-8-6-2)25(31)23(18-37-4)27-24(30)22(26-19(3)29)17-20-11-13-21(14-12-20)35-36(32,33)34/h11-14,22-23H,5-10,15-18H2,1-4H3,(H,26,29)(H,27,30)(H2,32,33,34)/t22-,23-/m0/s1 |
| InChIKey | ZIBFDAZSPSCLFW-GOTSBHOMSA-N |
| XLogP | 3.26 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|