C35H61N4O8P — CID 10556625
[4-[(2S)-2-acetamido-3-[[(2S)-1-[[(2S)-1-(dioctylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate (PubChem CID 10556625) has the molecular formula C35H61N4O8P and a molecular weight of 696.87 g/mol. Its IUPAC name is [4-[(2S)-2-acetamido-3-[[(2S)-1-[[(2S)-1-(dioctylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[(2S)-2-acetamido-3-[[(2S)-1-[[(2S)-1-(dioctylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10556625 |
| Molecular Formula | C35H61N4O8P |
| Molecular Weight | 696.87 g/mol |
| Exact Mass | 696.42 |
| IUPAC Name | [4-[(2S)-2-acetamido-3-[[(2S)-1-[[(2S)-1-(dioctylamino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-3-oxopropyl]phenyl] dihydrogen phosphate |
| SMILES | CCCCCCCCN(CCCCCCCC)C(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(C)=O)C(C)C |
| InChI | InChI=1S/C35H61N4O8P/c1-7-9-11-13-15-17-23-39(24-18-16-14-12-10-8-2)35(43)27(5)36-34(42)32(26(3)4)38-33(41)31(37-28(6)40)25-29-19-21-30(22-20-29)47-48(44,45)46/h19-22,26-27,31-32H,7-18,23-25H2,1-6H3,(H,36,42)(H,37,40)(H,38,41)(H2,44,45,46)/t27-,31-,32-/m0/s1 |
| InChIKey | NUFOBLSTYVVCSD-GFLPGQDNSA-N |
| XLogP | 5.40 |
| TPSA | 174.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.87 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|