C11H17ClNO5P — CID 19776350
2-amino-3-[4-(1-phosphonoethyl)phenyl]propanoic acid;hydrochloride (PubChem CID 19776350) has the molecular formula C11H17ClNO5P and a molecular weight of 309.69 g/mol. Its IUPAC name is 2-amino-3-[4-(1-phosphonoethyl)phenyl]propanoic acid;hydrochloride.
| Compound Name | 2-amino-3-[4-(1-phosphonoethyl)phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 19776350 |
| Molecular Formula | C11H17ClNO5P |
| Molecular Weight | 309.69 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-amino-3-[4-(1-phosphonoethyl)phenyl]propanoic acid;hydrochloride |
| SMILES | CC(c1ccc(CC(N)C(=O)O)cc1)P(=O)(O)O.Cl |
| InChI | InChI=1S/C11H16NO5P.ClH/c1-7(18(15,16)17)9-4-2-8(3-5-9)6-10(12)11(13)14;/h2-5,7,10H,6,12H2,1H3,(H,13,14)(H2,15,16,17);1H |
| InChIKey | PCNFUZAHGHWEOA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.69 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|