C32H39NO6 — CID 18625995
2-[[4-[2-[[4-[3-(ethoxymethoxymethyl)phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoic acid (PubChem CID 18625995) has the molecular formula C32H39NO6 and a molecular weight of 533.67 g/mol. Its IUPAC name is 2-[[4-[2-[[4-[3-(ethoxymethoxymethyl)phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoic acid.
| Compound Name | 2-[[4-[2-[[4-[3-(ethoxymethoxymethyl)phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoic acid |
|---|---|
| PubChem CID | 18625995 |
| Molecular Formula | C32H39NO6 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 2-[[4-[2-[[4-[3-(ethoxymethoxymethyl)phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoic acid |
| SMILES | CCCCC(Cc1ccc(OCCNC(=O)c2ccc(-c3cccc(COCOCC)c3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C32H39NO6/c1-3-5-8-29(32(35)36)20-24-10-16-30(17-11-24)39-19-18-33-31(34)27-14-12-26(13-15-27)28-9-6-7-25(21-28)22-38-23-37-4-2/h6-7,9-17,21,29H,3-5,8,18-20,22-23H2,1-2H3,(H,33,34)(H,35,36) |
| InChIKey | ONRWYCPMWRYPAQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|