C32H38NNaO6 — CID 70024962
sodium 2-[[4-[2-[[4-[3-[ethoxy(methoxy)methyl]phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoate (PubChem CID 70024962) has the molecular formula C32H38NNaO6 and a molecular weight of 555.65 g/mol. Its IUPAC name is sodium 2-[[4-[2-[[4-[3-[ethoxy(methoxy)methyl]phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoate.
| Compound Name | sodium 2-[[4-[2-[[4-[3-[ethoxy(methoxy)methyl]phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoate |
|---|---|
| PubChem CID | 70024962 |
| Molecular Formula | C32H38NNaO6 |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | sodium 2-[[4-[2-[[4-[3-[ethoxy(methoxy)methyl]phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoate |
| SMILES | CCCCC(Cc1ccc(OCCNC(=O)c2ccc(-c3cccc(C(OC)OCC)c3)cc2)cc1)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C32H39NO6.Na/c1-4-6-8-27(31(35)36)21-23-11-17-29(18-12-23)39-20-19-33-30(34)25-15-13-24(14-16-25)26-9-7-10-28(22-26)32(37-3)38-5-2;/h7,9-18,22,27,32H,4-6,8,19-21H2,1-3H3,(H,33,34)(H,35,36);/q;+1/p-1 |
| InChIKey | NRTCDPMBPBRTOU-UHFFFAOYSA-M |
| XLogP | 1.95 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|